C13H17NO2S — CID 66442992
2-(4-benzylthiomorpholin-3-yl)acetic acid (PubChem CID 66442992) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(4-benzylthiomorpholin-3-yl)acetic acid.
| Compound Name | 2-(4-benzylthiomorpholin-3-yl)acetic acid |
|---|---|
| PubChem CID | 66442992 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(4-benzylthiomorpholin-3-yl)acetic acid |
| SMILES | O=C(O)CC1CSCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO2S/c15-13(16)8-12-10-17-7-6-14(12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,15,16) |
| InChIKey | PFQSGDCKIHDVPF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |