C13H15F2NO2S — CID 66444778
2-[4-[(2,3-difluorophenyl)methyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66444778) has the molecular formula C13H15F2NO2S and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-[4-[(2,3-difluorophenyl)methyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(2,3-difluorophenyl)methyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66444778 |
| Molecular Formula | C13H15F2NO2S |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[4-[(2,3-difluorophenyl)methyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1Cc1cccc(F)c1F |
| InChI | InChI=1S/C13H15F2NO2S/c14-11-3-1-2-9(13(11)15)7-16-4-5-19-8-10(16)6-12(17)18/h1-3,10H,4-8H2,(H,17,18) |
| InChIKey | UVHKQCPIVXMYJK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |