C13H15ClN2O4S — CID 66443371
2-[4-[(4-chloro-2-nitrophenyl)methyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66443371) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2-nitrophenyl)methyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(4-chloro-2-nitrophenyl)methyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443371 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-[4-[(4-chloro-2-nitrophenyl)methyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1Cc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN2O4S/c14-10-2-1-9(12(5-10)16(19)20)7-15-3-4-21-8-11(15)6-13(17)18/h1-2,5,11H,3-4,6-8H2,(H,17,18) |
| InChIKey | TYBTVIUUVOGBNL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|