C13H15ClFNO2S — CID 114850994
2-[4-[(4-chloro-2-fluorophenyl)methyl]thiomorpholin-3-yl]acetic acid (PubChem CID 114850994) has the molecular formula C13H15ClFNO2S and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2-fluorophenyl)methyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(4-chloro-2-fluorophenyl)methyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 114850994 |
| Molecular Formula | C13H15ClFNO2S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[4-[(4-chloro-2-fluorophenyl)methyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H15ClFNO2S/c14-10-2-1-9(12(15)5-10)7-16-3-4-19-8-11(16)6-13(17)18/h1-2,5,11H,3-4,6-8H2,(H,17,18) |
| InChIKey | PFPNCHFMJHKTHR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |