C12H12F2N2O4S — CID 66443526
2-[4-(2,3-difluoro-6-nitrophenyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66443526) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-6-nitrophenyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2,3-difluoro-6-nitrophenyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443526 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[4-(2,3-difluoro-6-nitrophenyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1c1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C12H12F2N2O4S/c13-8-1-2-9(16(19)20)12(11(8)14)15-3-4-21-6-7(15)5-10(17)18/h1-2,7H,3-6H2,(H,17,18) |
| InChIKey | XLKKOMXWZXOEHN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|