C11H13N3O4S — CID 66444709
2-[4-(3-nitro-4-pyridinyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66444709) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[4-(3-nitro-4-pyridinyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(3-nitro-4-pyridinyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66444709 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[4-(3-nitro-4-pyridinyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1c1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O4S/c15-11(16)5-8-7-19-4-3-13(8)9-1-2-12-6-10(9)14(17)18/h1-2,6,8H,3-5,7H2,(H,15,16) |
| InChIKey | MMRZGCQQBNTAKU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|