C11H15N3O2S — CID 83063382
2-[4-(3-methylpyrazin-2-yl)thiomorpholin-3-yl]acetic acid (PubChem CID 83063382) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[4-(3-methylpyrazin-2-yl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(3-methylpyrazin-2-yl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 83063382 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[4-(3-methylpyrazin-2-yl)thiomorpholin-3-yl]acetic acid |
| SMILES | Cc1nccnc1N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C11H15N3O2S/c1-8-11(13-3-2-12-8)14-4-5-17-7-9(14)6-10(15)16/h2-3,9H,4-7H2,1H3,(H,15,16) |
| InChIKey | QKSKMPWCLYDRAQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |