C10H12ClN3O2S — CID 114335466
2-[4-(6-chloropyrazin-2-yl)thiomorpholin-3-yl]acetic acid (PubChem CID 114335466) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-[4-(6-chloropyrazin-2-yl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(6-chloropyrazin-2-yl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 114335466 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-[4-(6-chloropyrazin-2-yl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1c1cncc(Cl)n1 |
| InChI | InChI=1S/C10H12ClN3O2S/c11-8-4-12-5-9(13-8)14-1-2-17-6-7(14)3-10(15)16/h4-5,7H,1-3,6H2,(H,15,16) |
| InChIKey | KBPXWVSDEOGQIX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |