C9H12ClN3O2S2 — CID 66383089
4-(6-chloropyrazin-2-yl)-3-methylsulfonylthiomorpholine (PubChem CID 66383089) has the molecular formula C9H12ClN3O2S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 4-(6-chloropyrazin-2-yl)-3-methylsulfonylthiomorpholine.
| Compound Name | 4-(6-chloropyrazin-2-yl)-3-methylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66383089 |
| Molecular Formula | C9H12ClN3O2S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 4-(6-chloropyrazin-2-yl)-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1c1cncc(Cl)n1 |
| InChI | InChI=1S/C9H12ClN3O2S2/c1-17(14,15)9-6-16-3-2-13(9)8-5-11-4-7(10)12-8/h4-5,9H,2-3,6H2,1H3 |
| InChIKey | PNPUETMASCOXQP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |