C10H13ClN2O2S2 — CID 102824290
4-(2-chloro-4-pyridinyl)-3-methylsulfonylthiomorpholine (PubChem CID 102824290) has the molecular formula C10H13ClN2O2S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-3-methylsulfonylthiomorpholine.
| Compound Name | 4-(2-chloro-4-pyridinyl)-3-methylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 102824290 |
| Molecular Formula | C10H13ClN2O2S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2S2/c1-17(14,15)10-7-16-5-4-13(10)8-2-3-12-9(11)6-8/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | JMFZWWARDWWHMF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|