C13H18N2O2S3 — CID 81277243
2-methyl-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarbothioamide (PubChem CID 81277243) has the molecular formula C13H18N2O2S3 and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-methyl-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarbothioamide.
| Compound Name | 2-methyl-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 81277243 |
| Molecular Formula | C13H18N2O2S3 |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-methyl-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarbothioamide |
| SMILES | Cc1cc(N2CCSCC2S(C)(=O)=O)ccc1C(N)=S |
| InChI | InChI=1S/C13H18N2O2S3/c1-9-7-10(3-4-11(9)13(14)18)15-5-6-19-8-12(15)20(2,16)17/h3-4,7,12H,5-6,8H2,1-2H3,(H2,14,18) |
| InChIKey | YLEGKGVTZFZHTF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|