C12H16BrN3O2S2 — CID 107279347
2-bromo-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarboximidamide (PubChem CID 107279347) has the molecular formula C12H16BrN3O2S2 and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-bromo-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarboximidamide.
| Compound Name | 2-bromo-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107279347 |
| Molecular Formula | C12H16BrN3O2S2 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 2-bromo-4-(3-methylsulfonylthiomorpholin-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCSCC2S(C)(=O)=O)cc1Br |
| InChI | InChI=1S/C12H16BrN3O2S2/c1-20(17,18)11-7-19-5-4-16(11)8-2-3-9(12(14)15)10(13)6-8/h2-3,6,11H,4-5,7H2,1H3,(H3,14,15) |
| InChIKey | NNPXIFZEINEKQZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|