C11H13ClN2O4S2 — CID 114919770
5-chloro-2-(3-methylsulfonylthiomorpholin-4-yl)pyridine-4-carboxylic acid (PubChem CID 114919770) has the molecular formula C11H13ClN2O4S2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 5-chloro-2-(3-methylsulfonylthiomorpholin-4-yl)pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-(3-methylsulfonylthiomorpholin-4-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919770 |
| Molecular Formula | C11H13ClN2O4S2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 5-chloro-2-(3-methylsulfonylthiomorpholin-4-yl)pyridine-4-carboxylic acid |
| SMILES | CS(=O)(=O)C1CSCCN1c1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C11H13ClN2O4S2/c1-20(17,18)10-6-19-3-2-14(10)9-4-7(11(15)16)8(12)5-13-9/h4-5,10H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | VPMLMTNFGMOAKV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |