C12H14Cl2N2O3S2 — CID 114918642
(2,5-dichloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 114918642) has the molecular formula C12H14Cl2N2O3S2 and a molecular weight of 369.30 g/mol. Its IUPAC name is (2,5-dichloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (2,5-dichloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 114918642 |
| Molecular Formula | C12H14Cl2N2O3S2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | (2,5-dichloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3S2/c1-2-21(18,19)11-7-20-4-3-16(11)12(17)8-5-10(14)15-6-9(8)13/h5-6,11H,2-4,7H2,1H3 |
| InChIKey | XXUGFOYHYLUXOC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|