C13H15BrFNO3S2 — CID 107952634
(3-bromo-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 107952634) has the molecular formula C13H15BrFNO3S2 and a molecular weight of 396.30 g/mol. Its IUPAC name is (3-bromo-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (3-bromo-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107952634 |
| Molecular Formula | C13H15BrFNO3S2 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | (3-bromo-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C13H15BrFNO3S2/c1-2-21(18,19)11-8-20-7-6-16(11)13(17)9-4-3-5-10(14)12(9)15/h3-5,11H,2,6-8H2,1H3 |
| InChIKey | MORATZVPNSBGQZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |