C13H15ClFNO3S2 — CID 66377730
(5-chloro-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66377730) has the molecular formula C13H15ClFNO3S2 and a molecular weight of 351.85 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66377730 |
| Molecular Formula | C13H15ClFNO3S2 |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H15ClFNO3S2/c1-2-21(18,19)12-8-20-6-5-16(12)13(17)10-7-9(14)3-4-11(10)15/h3-4,7,12H,2,5-6,8H2,1H3 |
| InChIKey | NQAPWQKZPZFPQJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |