C13H16ClNO4S2 — CID 66377184
(4-chloro-2-hydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66377184) has the molecular formula C13H16ClNO4S2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (4-chloro-2-hydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (4-chloro-2-hydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66377184 |
| Molecular Formula | C13H16ClNO4S2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | (4-chloro-2-hydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C13H16ClNO4S2/c1-2-21(18,19)12-8-20-6-5-15(12)13(17)10-4-3-9(14)7-11(10)16/h3-4,7,12,16H,2,5-6,8H2,1H3 |
| InChIKey | GYRBMDVYQPYKKF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |