C12H12ClNO4S — CID 82901277
4-(4-chloro-2-hydroxybenzoyl)thiomorpholine-3-carboxylic acid (PubChem CID 82901277) has the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. Its IUPAC name is 4-(4-chloro-2-hydroxybenzoyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(4-chloro-2-hydroxybenzoyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82901277 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-(4-chloro-2-hydroxybenzoyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H12ClNO4S/c13-7-1-2-8(10(15)5-7)11(16)14-3-4-19-6-9(14)12(17)18/h1-2,5,9,15H,3-4,6H2,(H,17,18) |
| InChIKey | ZPGXXFSOIJHYLV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |