C12H10Cl2INO3S — CID 78979467
4-(3,5-dichloro-2-iodobenzoyl)thiomorpholine-3-carboxylic acid (PubChem CID 78979467) has the molecular formula C12H10Cl2INO3S and a molecular weight of 446.09 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-iodobenzoyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(3,5-dichloro-2-iodobenzoyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78979467 |
| Molecular Formula | C12H10Cl2INO3S |
| Molecular Weight | 446.09 g/mol |
| Exact Mass | 444.88 |
| IUPAC Name | 4-(3,5-dichloro-2-iodobenzoyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C12H10Cl2INO3S/c13-6-3-7(10(15)8(14)4-6)11(17)16-1-2-20-5-9(16)12(18)19/h3-4,9H,1-2,5H2,(H,18,19) |
| InChIKey | NJQAWQHBXLMUKA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|