C14H13Cl2NO3S — CID 78979510
4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid (PubChem CID 78979510) has the molecular formula C14H13Cl2NO3S and a molecular weight of 346.24 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78979510 |
| Molecular Formula | C14H13Cl2NO3S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NO3S/c15-10-5-9(6-11(16)7-10)1-2-13(18)17-3-4-21-8-12(17)14(19)20/h1-2,5-7,12H,3-4,8H2,(H,19,20)/b2-1+ |
| InChIKey | LSRUSQQTYRMPOJ-OWOJBTEDSA-N |
| XLogP | 3.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|