C13H11Cl2NO3S — CID 43359550
3-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 43359550) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 43359550 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 3-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1C(=O)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S/c14-9-3-8(4-10(15)5-9)1-2-12(17)16-7-20-6-11(16)13(18)19/h1-5,11H,6-7H2,(H,18,19)/b2-1+ |
| InChIKey | JAWHZVGIPGWYSS-OWOJBTEDSA-N |
| XLogP | 2.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|