C17H21ClN2O2S — CID 60609103
3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 60609103) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 60609103 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-N-(2-methylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1CSCN1C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O2S/c1-12(2)9-19-17(22)15-10-23-11-20(15)16(21)8-5-13-3-6-14(18)7-4-13/h3-8,12,15H,9-11H2,1-2H3,(H,19,22)/b8-5+ |
| InChIKey | DKTCLSCYWJLSPA-VMPITWQZSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|