C20H19FN2O2S — CID 86809176
N-[(4-fluorophenyl)methyl]-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 86809176) has the molecular formula C20H19FN2O2S and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 86809176 |
| Molecular Formula | C20H19FN2O2S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1CSCN1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H19FN2O2S/c21-17-9-6-16(7-10-17)12-22-20(25)18-13-26-14-23(18)19(24)11-8-15-4-2-1-3-5-15/h1-11,18H,12-14H2,(H,22,25)/b11-8+ |
| InChIKey | DGBZXOXIUSUWMF-DHZHZOJOSA-N |
| XLogP | 3.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|