C21H30N2O2S — CID 52846319
(4S)-N-tert-butyl-3-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 52846319) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is (4S)-N-tert-butyl-3-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-tert-butyl-3-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 52846319 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (4S)-N-tert-butyl-3-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1CSCN1C(=O)/C=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O2S/c1-20(2,3)16-10-7-15(8-11-16)9-12-18(24)23-14-26-13-17(23)19(25)22-21(4,5)6/h7-12,17H,13-14H2,1-6H3,(H,22,25)/b12-9+/t17-/m1/s1 |
| InChIKey | BMRFNQBFEWCNTR-XLNAKTSKSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|