C15H17NO4S — CID 78979616
4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid (PubChem CID 78979616) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78979616 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]thiomorpholine-3-carboxylic acid |
| SMILES | COc1ccc(/C=C/C(=O)N2CCSCC2C(=O)O)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-20-12-5-2-11(3-6-12)4-7-14(17)16-8-9-21-10-13(16)15(18)19/h2-7,13H,8-10H2,1H3,(H,18,19)/b7-4+ |
| InChIKey | TVENMQNYLVLCDW-QPJJXVBHSA-N |
| XLogP | 1.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|