C18H21F2NO5S — CID 18146580
ethyl 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]thiomorpholine-3-carboxylate (PubChem CID 18146580) has the molecular formula C18H21F2NO5S and a molecular weight of 401.43 g/mol. Its IUPAC name is ethyl 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 18146580 |
| Molecular Formula | C18H21F2NO5S |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | ethyl 4-[(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1C(=O)/C=C/c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H21F2NO5S/c1-3-25-17(23)13-11-27-9-8-21(13)16(22)7-5-12-4-6-14(26-18(19)20)15(10-12)24-2/h4-7,10,13,18H,3,8-9,11H2,1-2H3/b7-5+ |
| InChIKey | SHKKDSNKKLFNQP-FNORWQNLSA-N |
| XLogP | 2.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|