C17H22F2N2O4 — CID 78838074
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 78838074) has the molecular formula C17H22F2N2O4 and a molecular weight of 356.37 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 78838074 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(CCO)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C17H22F2N2O4/c1-24-15-12-13(2-4-14(15)25-17(18)19)3-5-16(23)21-8-6-20(7-9-21)10-11-22/h2-5,12,17,22H,6-11H2,1H3/b5-3+ |
| InChIKey | LTDFIRSKLMFVJI-HWKANZROSA-N |
| XLogP | 1.45 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|