C12H13NO5S — CID 82901491
4-(2,4-dihydroxybenzoyl)thiomorpholine-3-carboxylic acid (PubChem CID 82901491) has the molecular formula C12H13NO5S and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-(2,4-dihydroxybenzoyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(2,4-dihydroxybenzoyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82901491 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-(2,4-dihydroxybenzoyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H13NO5S/c14-7-1-2-8(10(15)5-7)11(16)13-3-4-19-6-9(13)12(17)18/h1-2,5,9,14-15H,3-4,6H2,(H,17,18) |
| InChIKey | IKQNHSSGANCGQV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |