C13H17NO5S2 — CID 107723282
(2,4-dihydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 107723282) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (2,4-dihydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107723282 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (2,4-dihydroxyphenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H17NO5S2/c1-2-21(18,19)12-8-20-6-5-14(12)13(17)10-4-3-9(15)7-11(10)16/h3-4,7,12,15-16H,2,5-6,8H2,1H3 |
| InChIKey | LAMNFMSZZKCELV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |