C12H15NO5S3 — CID 66377198
5-(3-ethylsulfonylthiomorpholine-4-carbonyl)thiophene-2-carboxylic acid (PubChem CID 66377198) has the molecular formula C12H15NO5S3 and a molecular weight of 349.46 g/mol. Its IUPAC name is 5-(3-ethylsulfonylthiomorpholine-4-carbonyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(3-ethylsulfonylthiomorpholine-4-carbonyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66377198 |
| Molecular Formula | C12H15NO5S3 |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-(3-ethylsulfonylthiomorpholine-4-carbonyl)thiophene-2-carboxylic acid |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C12H15NO5S3/c1-2-21(17,18)10-7-19-6-5-13(10)11(14)8-3-4-9(20-8)12(15)16/h3-4,10H,2,5-7H2,1H3,(H,15,16) |
| InChIKey | UBZYPYVPBUQHAD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |