C11H15NO3S3 — CID 66375654
(3-ethylsulfonylthiomorpholin-4-yl)-thiophen-2-ylmethanone (PubChem CID 66375654) has the molecular formula C11H15NO3S3 and a molecular weight of 305.45 g/mol. Its IUPAC name is (3-ethylsulfonylthiomorpholin-4-yl)-thiophen-2-ylmethanone.
| Compound Name | (3-ethylsulfonylthiomorpholin-4-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 66375654 |
| Molecular Formula | C11H15NO3S3 |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | (3-ethylsulfonylthiomorpholin-4-yl)-thiophen-2-ylmethanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C11H15NO3S3/c1-2-18(14,15)10-8-16-7-5-12(10)11(13)9-4-3-6-17-9/h3-4,6,10H,2,5,7-8H2,1H3 |
| InChIKey | BNMPLICLXWMNPG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |