C13H17BrN2O3S2 — CID 66378521
(4-amino-3-bromophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66378521) has the molecular formula C13H17BrN2O3S2 and a molecular weight of 393.33 g/mol. Its IUPAC name is (4-amino-3-bromophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (4-amino-3-bromophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66378521 |
| Molecular Formula | C13H17BrN2O3S2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | (4-amino-3-bromophenyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O3S2/c1-2-21(18,19)12-8-20-6-5-16(12)13(17)9-3-4-11(15)10(14)7-9/h3-4,7,12H,2,5-6,8,15H2,1H3 |
| InChIKey | VPVSPLUPAHQWKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|