C11H18N4O3S2 — CID 66384069
(4-amino-1-methylpyrazol-3-yl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66384069) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (4-amino-1-methylpyrazol-3-yl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (4-amino-1-methylpyrazol-3-yl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66384069 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (4-amino-1-methylpyrazol-3-yl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1nn(C)cc1N |
| InChI | InChI=1S/C11H18N4O3S2/c1-3-20(17,18)9-7-19-5-4-15(9)11(16)10-8(12)6-14(2)13-10/h6,9H,3-5,7,12H2,1-2H3 |
| InChIKey | KJECYGAPYKJZRZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |