C12H18N4O3S2 — CID 66377589
(3-ethylsulfonylthiomorpholin-4-yl)-(6-hydrazinyl-2-pyridinyl)methanone (PubChem CID 66377589) has the molecular formula C12H18N4O3S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is (3-ethylsulfonylthiomorpholin-4-yl)-(6-hydrazinyl-2-pyridinyl)methanone.
| Compound Name | (3-ethylsulfonylthiomorpholin-4-yl)-(6-hydrazinyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 66377589 |
| Molecular Formula | C12H18N4O3S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (3-ethylsulfonylthiomorpholin-4-yl)-(6-hydrazinyl-2-pyridinyl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cccc(NN)n1 |
| InChI | InChI=1S/C12H18N4O3S2/c1-2-21(18,19)11-8-20-7-6-16(11)12(17)9-4-3-5-10(14-9)15-13/h3-5,11H,2,6-8,13H2,1H3,(H,14,15) |
| InChIKey | DGWLQINJQFCFFS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|