C10H16N4O3S2 — CID 66370150
(4-amino-1-methylpyrazol-3-yl)-(3-methylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 66370150) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is (4-amino-1-methylpyrazol-3-yl)-(3-methylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (4-amino-1-methylpyrazol-3-yl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 66370150 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (4-amino-1-methylpyrazol-3-yl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | Cn1cc(N)c(C(=O)N2CCSCC2S(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-13-5-7(11)9(12-13)10(15)14-3-4-18-6-8(14)19(2,16)17/h5,8H,3-4,6,11H2,1-2H3 |
| InChIKey | XGYTVJRWHDJOGJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |