C11H13BrN2O3S2 — CID 107519120
(3-bromo-2-pyridinyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 107519120) has the molecular formula C11H13BrN2O3S2 and a molecular weight of 365.27 g/mol. Its IUPAC name is (3-bromo-2-pyridinyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (3-bromo-2-pyridinyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107519120 |
| Molecular Formula | C11H13BrN2O3S2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | (3-bromo-2-pyridinyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)c1ncccc1Br |
| InChI | InChI=1S/C11H13BrN2O3S2/c1-19(16,17)9-7-18-6-5-14(9)11(15)10-8(12)3-2-4-13-10/h2-4,9H,5-7H2,1H3 |
| InChIKey | AYKHHUSMPNDULC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |