C14H17BrN2OS — CID 129402805
[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-(3-bromo-2-pyridinyl)methanone (PubChem CID 129402805) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-(3-bromo-2-pyridinyl)methanone.
| Compound Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-(3-bromo-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 129402805 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl]-(3-bromo-2-pyridinyl)methanone |
| SMILES | O=C(c1ncccc1Br)N1CCS[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H17BrN2OS/c15-10-4-3-7-16-13(10)14(18)17-8-9-19-12-6-2-1-5-11(12)17/h3-4,7,11-12H,1-2,5-6,8-9H2/t11-,12-/m1/s1 |
| InChIKey | OFNLLAICFPFMKX-VXGBXAGGSA-N |
| XLogP | 3.34 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |