C14H18N2O2S — CID 127612447
3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(2-methyl-3-pyridinyl)methanone (PubChem CID 127612447) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(2-methyl-3-pyridinyl)methanone.
| Compound Name | 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(2-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 127612447 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(2-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ncccc1C(=O)N1CCSC2COCCC21 |
| InChI | InChI=1S/C14H18N2O2S/c1-10-11(3-2-5-15-10)14(17)16-6-8-19-13-9-18-7-4-12(13)16/h2-3,5,12-13H,4,6-9H2,1H3 |
| InChIKey | BNSJOPFKCAAZAE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |