C12H14ClNO2S2 — CID 75429662
3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(5-chlorothiophen-2-yl)methanone (PubChem CID 75429662) has the molecular formula C12H14ClNO2S2 and a molecular weight of 303.84 g/mol. Its IUPAC name is 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(5-chlorothiophen-2-yl)methanone.
| Compound Name | 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(5-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 75429662 |
| Molecular Formula | C12H14ClNO2S2 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl-(5-chlorothiophen-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)s1)N1CCSC2COCCC21 |
| InChI | InChI=1S/C12H14ClNO2S2/c13-11-2-1-9(18-11)12(15)14-4-6-17-10-7-16-5-3-8(10)14/h1-2,8,10H,3-7H2 |
| InChIKey | PKAWFWXEEUARGN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |