C15H19NO4S — CID 129470637
5-[(2R)-2-(oxan-4-yl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid (PubChem CID 129470637) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 5-[(2R)-2-(oxan-4-yl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(2R)-2-(oxan-4-yl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 129470637 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-[(2R)-2-(oxan-4-yl)pyrrolidine-1-carbonyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC[C@@H]2C2CCOCC2)s1 |
| InChI | InChI=1S/C15H19NO4S/c17-14(12-3-4-13(21-12)15(18)19)16-7-1-2-11(16)10-5-8-20-9-6-10/h3-4,10-11H,1-2,5-9H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | GNLXWZNRIUBMAG-LLVKDONJSA-N |
| XLogP | 2.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |