C19H26ClNO2S — CID 59542566
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-chloro-5-(oxan-4-yl)thiophen-3-yl]methanone (PubChem CID 59542566) has the molecular formula C19H26ClNO2S and a molecular weight of 367.94 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-chloro-5-(oxan-4-yl)thiophen-3-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-chloro-5-(oxan-4-yl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 59542566 |
| Molecular Formula | C19H26ClNO2S |
| Molecular Weight | 367.94 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[2-chloro-5-(oxan-4-yl)thiophen-3-yl]methanone |
| SMILES | O=C(c1cc(C2CCOCC2)sc1Cl)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H26ClNO2S/c20-18-15(12-17(24-18)14-7-10-23-11-8-14)19(22)21-9-3-5-13-4-1-2-6-16(13)21/h12-14,16H,1-11H2 |
| InChIKey | DYFMGAYIBUTIKX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |