C18H28ClNOS — CID 143816900
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-chloro-5-ethylthiophen-3-yl)methanone;ethane (PubChem CID 143816900) has the molecular formula C18H28ClNOS and a molecular weight of 341.95 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-chloro-5-ethylthiophen-3-yl)methanone;ethane.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-chloro-5-ethylthiophen-3-yl)methanone;ethane |
|---|---|
| PubChem CID | 143816900 |
| Molecular Formula | C18H28ClNOS |
| Molecular Weight | 341.95 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-chloro-5-ethylthiophen-3-yl)methanone;ethane |
| SMILES | CC.CCc1cc(C(=O)N2CCCC3CCCCC32)c(Cl)s1 |
| InChI | InChI=1S/C16H22ClNOS.C2H6/c1-2-12-10-13(15(17)20-12)16(19)18-9-5-7-11-6-3-4-8-14(11)18;1-2/h10-11,14H,2-9H2,1H3;1-2H3 |
| InChIKey | NGZXTDBCUJVNQM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.95 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |