C17H18ClNOS — CID 42643878
(2-chloro-5-ethylthiophen-3-yl)-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 42643878) has the molecular formula C17H18ClNOS and a molecular weight of 319.86 g/mol. Its IUPAC name is (2-chloro-5-ethylthiophen-3-yl)-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (2-chloro-5-ethylthiophen-3-yl)-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 42643878 |
| Molecular Formula | C17H18ClNOS |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (2-chloro-5-ethylthiophen-3-yl)-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCC(c3ccccc3)C2)c(Cl)s1 |
| InChI | InChI=1S/C17H18ClNOS/c1-2-14-10-15(16(18)21-14)17(20)19-9-8-13(11-19)12-6-4-3-5-7-12/h3-7,10,13H,2,8-9,11H2,1H3 |
| InChIKey | YZMXGQLKCAEAQL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |