C13H18N2O3S3 — CID 125131191
(6-ethylsulfanyl-3-pyridinyl)-[(3S)-3-methylsulfonylthiomorpholin-4-yl]methanone (PubChem CID 125131191) has the molecular formula C13H18N2O3S3 and a molecular weight of 346.50 g/mol. Its IUPAC name is (6-ethylsulfanyl-3-pyridinyl)-[(3S)-3-methylsulfonylthiomorpholin-4-yl]methanone.
| Compound Name | (6-ethylsulfanyl-3-pyridinyl)-[(3S)-3-methylsulfonylthiomorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 125131191 |
| Molecular Formula | C13H18N2O3S3 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (6-ethylsulfanyl-3-pyridinyl)-[(3S)-3-methylsulfonylthiomorpholin-4-yl]methanone |
| SMILES | CCSc1ccc(C(=O)N2CCSC[C@@H]2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C13H18N2O3S3/c1-3-20-11-5-4-10(8-14-11)13(16)15-6-7-19-9-12(15)21(2,17)18/h4-5,8,12H,3,6-7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | UOQCFWIMAJAJQQ-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |