C18H27N3O2S — CID 56786574
N-tert-butyl-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidine-2-carboxamide (PubChem CID 56786574) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-tert-butyl-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-tert-butyl-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 56786574 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-tert-butyl-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidine-2-carboxamide |
| SMILES | CCSc1ccc(C(=O)N2CCCCC2C(=O)NC(C)(C)C)cn1 |
| InChI | InChI=1S/C18H27N3O2S/c1-5-24-15-10-9-13(12-19-15)17(23)21-11-7-6-8-14(21)16(22)20-18(2,3)4/h9-10,12,14H,5-8,11H2,1-4H3,(H,20,22) |
| InChIKey | DVCUBGCZVNVSFJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |