C15H22N4O2S — CID 95593964
[(2S)-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidin-2-yl]methylurea (PubChem CID 95593964) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(2S)-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidin-2-yl]methylurea.
| Compound Name | [(2S)-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidin-2-yl]methylurea |
|---|---|
| PubChem CID | 95593964 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [(2S)-1-(6-ethylsulfanylpyridine-3-carbonyl)piperidin-2-yl]methylurea |
| SMILES | CCSc1ccc(C(=O)N2CCCC[C@H]2CNC(N)=O)cn1 |
| InChI | InChI=1S/C15H22N4O2S/c1-2-22-13-7-6-11(9-17-13)14(20)19-8-4-3-5-12(19)10-18-15(16)21/h6-7,9,12H,2-5,8,10H2,1H3,(H3,16,18,21)/t12-/m0/s1 |
| InChIKey | VGQBWNOGEMSADY-LBPRGKRZSA-N |
| XLogP | 1.86 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |