C14H16F3N3O2 — CID 56826500
[1-(3,4,5-trifluorobenzoyl)piperidin-2-yl]methylurea (PubChem CID 56826500) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is [1-(3,4,5-trifluorobenzoyl)piperidin-2-yl]methylurea.
| Compound Name | [1-(3,4,5-trifluorobenzoyl)piperidin-2-yl]methylurea |
|---|---|
| PubChem CID | 56826500 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [1-(3,4,5-trifluorobenzoyl)piperidin-2-yl]methylurea |
| SMILES | NC(=O)NCC1CCCCN1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H16F3N3O2/c15-10-5-8(6-11(16)12(10)17)13(21)20-4-2-1-3-9(20)7-19-14(18)22/h5-6,9H,1-4,7H2,(H3,18,19,22) |
| InChIKey | IHLASULHYGWECV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|