C14H16F3NO2 — CID 63186797
[2-(3-hydroxypropyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 63186797) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is [2-(3-hydroxypropyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(3-hydroxypropyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 63186797 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [2-(3-hydroxypropyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)N1CCCC1CCCO |
| InChI | InChI=1S/C14H16F3NO2/c15-11-7-9(8-12(16)13(11)17)14(20)18-5-1-3-10(18)4-2-6-19/h7-8,10,19H,1-6H2 |
| InChIKey | IWPYUABYBBOSNZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|