C12H11ClF3NO — CID 63394259
[2-(chloromethyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 63394259) has the molecular formula C12H11ClF3NO and a molecular weight of 277.67 g/mol. Its IUPAC name is [2-(chloromethyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(chloromethyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 63394259 |
| Molecular Formula | C12H11ClF3NO |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [2-(chloromethyl)pyrrolidin-1-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)N1CCCC1CCl |
| InChI | InChI=1S/C12H11ClF3NO/c13-6-8-2-1-3-17(8)12(18)7-4-9(14)11(16)10(15)5-7/h4-5,8H,1-3,6H2 |
| InChIKey | PWUZRPWWDWPMTL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|