C14H16FN3O2 — CID 63979920
N-cyclopropyl-1-(6-fluoropyridine-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 63979920) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is N-cyclopropyl-1-(6-fluoropyridine-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-(6-fluoropyridine-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 63979920 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-cyclopropyl-1-(6-fluoropyridine-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C14H16FN3O2/c15-12-6-3-9(8-16-12)14(20)18-7-1-2-11(18)13(19)17-10-4-5-10/h3,6,8,10-11H,1-2,4-5,7H2,(H,17,19) |
| InChIKey | QAXRAHSAQLSCPQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|